C16H27ClN2S — CID 43692479
N-[1-(5-chlorothiophen-2-yl)ethyl]-1-(1-propylpiperidin-4-yl)ethanamine (PubChem CID 43692479) has the molecular formula C16H27ClN2S and a molecular weight of 314.93 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-1-(1-propylpiperidin-4-yl)ethanamine.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-1-(1-propylpiperidin-4-yl)ethanamine |
|---|---|
| PubChem CID | 43692479 |
| Molecular Formula | C16H27ClN2S |
| Molecular Weight | 314.93 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-1-(1-propylpiperidin-4-yl)ethanamine |
| SMILES | CCCN1CCC(C(C)NC(C)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H27ClN2S/c1-4-9-19-10-7-14(8-11-19)12(2)18-13(3)15-5-6-16(17)20-15/h5-6,12-14,18H,4,7-11H2,1-3H3 |
| InChIKey | ZOIFYVNXYDGNSE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.93 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |