C16H21N3 — CID 43694345
4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]benzonitrile (PubChem CID 43694345) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]benzonitrile.
| Compound Name | 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 43694345 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNC2CCN3CCCCC23)cc1 |
| InChI | InChI=1S/C16H21N3/c17-11-13-4-6-14(7-5-13)12-18-15-8-10-19-9-2-1-3-16(15)19/h4-7,15-16,18H,1-3,8-10,12H2 |
| InChIKey | QPXLAGXKYWXJSM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |