C17H18ClF2N — CID 43694819
1-(3-chlorophenyl)-N-[1-(2,4-difluorophenyl)ethyl]propan-2-amine (PubChem CID 43694819) has the molecular formula C17H18ClF2N and a molecular weight of 309.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[1-(2,4-difluorophenyl)ethyl]propan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-N-[1-(2,4-difluorophenyl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 43694819 |
| Molecular Formula | C17H18ClF2N |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[1-(2,4-difluorophenyl)ethyl]propan-2-amine |
| SMILES | CC(Cc1cccc(Cl)c1)NC(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H18ClF2N/c1-11(8-13-4-3-5-14(18)9-13)21-12(2)16-7-6-15(19)10-17(16)20/h3-7,9-12,21H,8H2,1-2H3 |
| InChIKey | FKAWYUZPRCKJNH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |