C13H14N4O3 — CID 43695077
2-[4-(1,3-benzodioxol-4-ylmethylamino)pyrazol-1-yl]acetamide (PubChem CID 43695077) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-4-ylmethylamino)pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-4-ylmethylamino)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 43695077 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-4-ylmethylamino)pyrazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(NCc2cccc3c2OCO3)cn1 |
| InChI | InChI=1S/C13H14N4O3/c14-12(18)7-17-6-10(5-16-17)15-4-9-2-1-3-11-13(9)20-8-19-11/h1-3,5-6,15H,4,7-8H2,(H2,14,18) |
| InChIKey | IEUINDAKWLNLJV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |