About Glucose beta-1,3-isofagamine
Glucose beta-1,3-isofagamine (PubChem CID 4369540) has the molecular formula C12H23NO8
and a molecular weight of 309.31 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)piperidin-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
Molecular Properties
| Compound Name | Glucose beta-1,3-isofagamine |
| PubChem CID | 4369540 |
| Molecular Formula | C12H23NO8 |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)piperidin-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C1[C@@H]([C@H]([C@@H](CN1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)CO |
| InChI | InChI=1S/C12H23NO8/c14-3-5-1-13-2-6(8(5)16)20-12-11(19)10(18)9(17)7(4-15)21-12/h5-19H,1-4H2/t5-,6-,7-,8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | BEXVSXHKIARRKH-FYKVHUBJSA-N |
| XLogP | -3.10 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 332 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze Glucose beta-1,3-isofagamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Glucose beta-1,3-isofagamine?
The IUPAC name of Glucose beta-1,3-isofagamine (CID 4369540) is (2R,3R,4S,5S,6R)-2-[(3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)piperidin-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the SMILES notation for Glucose beta-1,3-isofagamine?
The canonical SMILES for Glucose beta-1,3-isofagamine is C1[C@@H]([C@H]([C@@H](CN1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)CO.
What is the InChIKey of Glucose beta-1,3-isofagamine?
The InChIKey is BEXVSXHKIARRKH-FYKVHUBJSA-N. The full InChI is InChI=1S/C12H23NO8/c14-3-5-1-13-2-6(8(5)16)20-12-11(19)10(18)9(17)7(4-15)21-12/h5-19H,1-4H2/t5-,6-,7-,8-,9-,10+,11-,12-/m1/s1.
What are the key properties of Glucose beta-1,3-isofagamine?
Glucose beta-1,3-isofagamine has a molecular weight of 309.31 g/mol, XLogP of -3.10, 4 rotatable bonds, 7 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for Glucose beta-1,3-isofagamine is sourced from PubChem (CID 4369540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).