C14H18ClN5 — CID 43697984
2-chloro-N-(3-methylcyclohexyl)-5-(tetrazol-1-yl)aniline (PubChem CID 43697984) has the molecular formula C14H18ClN5 and a molecular weight of 291.79 g/mol. Its IUPAC name is 2-chloro-N-(3-methylcyclohexyl)-5-(tetrazol-1-yl)aniline.
| Compound Name | 2-chloro-N-(3-methylcyclohexyl)-5-(tetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 43697984 |
| Molecular Formula | C14H18ClN5 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-chloro-N-(3-methylcyclohexyl)-5-(tetrazol-1-yl)aniline |
| SMILES | CC1CCCC(Nc2cc(-n3cnnn3)ccc2Cl)C1 |
| InChI | InChI=1S/C14H18ClN5/c1-10-3-2-4-11(7-10)17-14-8-12(5-6-13(14)15)20-9-16-18-19-20/h5-6,8-11,17H,2-4,7H2,1H3 |
| InChIKey | KPWFTVQJXQNTPE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |