C13H23F3N2O2 — CID 43698435
2-amino-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]pentanamide (PubChem CID 43698435) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-amino-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]pentanamide.
| Compound Name | 2-amino-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]pentanamide |
|---|---|
| PubChem CID | 43698435 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-amino-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]pentanamide |
| SMILES | CCCC(N)C(=O)NC1CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H23F3N2O2/c1-2-4-11(17)12(19)18-9-5-3-6-10(7-9)20-8-13(14,15)16/h9-11H,2-8,17H2,1H3,(H,18,19) |
| InChIKey | NRLXJHVXEFOWBS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |