C13H25ClN2O — CID 43700529
5-chloro-N-(1-propan-2-ylpiperidin-4-yl)pentanamide (PubChem CID 43700529) has the molecular formula C13H25ClN2O and a molecular weight of 260.81 g/mol. Its IUPAC name is 5-chloro-N-(1-propan-2-ylpiperidin-4-yl)pentanamide.
| Compound Name | 5-chloro-N-(1-propan-2-ylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 43700529 |
| Molecular Formula | C13H25ClN2O |
| Molecular Weight | 260.81 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 5-chloro-N-(1-propan-2-ylpiperidin-4-yl)pentanamide |
| SMILES | CC(C)N1CCC(NC(=O)CCCCCl)CC1 |
| InChI | InChI=1S/C13H25ClN2O/c1-11(2)16-9-6-12(7-10-16)15-13(17)5-3-4-8-14/h11-12H,3-10H2,1-2H3,(H,15,17) |
| InChIKey | UPHZASJGLSTXEN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|