About 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide
5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide (PubChem CID 43701300) has the molecular formula C13H26ClNO
and a molecular weight of 247.81 g/mol. Its IUPAC name is 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide.
Molecular Properties
| Compound Name | 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide |
| PubChem CID | 43701300 |
| Molecular Formula | C13H26ClNO |
| Molecular Weight | 247.81 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CCCCCl |
| InChI | InChI=1S/C13H26ClNO/c1-12(2,3)10-13(4,5)15-11(16)8-6-7-9-14/h6-10H2,1-5H3,(H,15,16) |
| InChIKey | BAQACVKRLKDYDI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide?
The IUPAC name of 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide (CID 43701300) is 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide.
What is the SMILES notation for 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide?
The canonical SMILES for 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide is CC(C)(C)CC(C)(C)NC(=O)CCCCCl.
What is the InChIKey of 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide?
The InChIKey is BAQACVKRLKDYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26ClNO/c1-12(2,3)10-13(4,5)15-11(16)8-6-7-9-14/h6-10H2,1-5H3,(H,15,16).
What are the key properties of 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide?
5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide has a molecular weight of 247.81 g/mol, XLogP of 3.73, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(2,4,4-trimethylpentan-2-yl)pentanamide is sourced from PubChem (CID 43701300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).