C11H13N3O — CID 43701914
N-ethyl-2-methyl-5-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 43701914) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is N-ethyl-2-methyl-5-(1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | N-ethyl-2-methyl-5-(1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 43701914 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-ethyl-2-methyl-5-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | CCNc1cc(-c2nnco2)ccc1C |
| InChI | InChI=1S/C11H13N3O/c1-3-12-10-6-9(5-4-8(10)2)11-14-13-7-15-11/h4-7,12H,3H2,1-2H3 |
| InChIKey | LHFXELSUCXMYIV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |