C11H13N3OS — CID 43702545
2-amino-N-(2-methyl-1,3-benzothiazol-6-yl)propanamide (PubChem CID 43702545) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-amino-N-(2-methyl-1,3-benzothiazol-6-yl)propanamide.
| Compound Name | 2-amino-N-(2-methyl-1,3-benzothiazol-6-yl)propanamide |
|---|---|
| PubChem CID | 43702545 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-amino-N-(2-methyl-1,3-benzothiazol-6-yl)propanamide |
| SMILES | Cc1nc2ccc(NC(=O)C(C)N)cc2s1 |
| InChI | InChI=1S/C11H13N3OS/c1-6(12)11(15)14-8-3-4-9-10(5-8)16-7(2)13-9/h3-6H,12H2,1-2H3,(H,14,15) |
| InChIKey | FVVGMJSKNKFNAA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |