About N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline
N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline (PubChem CID 43704826) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline.
Molecular Properties
| Compound Name | N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline |
| PubChem CID | 43704826 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline |
| SMILES | CCC(C)CC(CC)Nc1ccc(-c2coc(C)n2)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-5-13(3)11-16(6-2)20-17-9-7-15(8-10-17)18-12-21-14(4)19-18/h7-10,12-13,16,20H,5-6,11H2,1-4H3 |
| InChIKey | RIURMSOMFOOGCH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline?
The IUPAC name of N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline (CID 43704826) is N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline.
What is the SMILES notation for N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline?
The canonical SMILES for N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline is CCC(C)CC(CC)Nc1ccc(-c2coc(C)n2)cc1.
What is the InChIKey of N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline?
The InChIKey is RIURMSOMFOOGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O/c1-5-13(3)11-16(6-2)20-17-9-7-15(8-10-17)18-12-21-14(4)19-18/h7-10,12-13,16,20H,5-6,11H2,1-4H3.
What are the key properties of N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline?
N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline has a molecular weight of 286.42 g/mol, XLogP of 5.28, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methylheptan-3-yl)-4-(2-methyl-1,3-oxazol-4-yl)aniline is sourced from PubChem (CID 43704826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).