About 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide
6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide (PubChem CID 43706315) has the molecular formula C11H21N5O
and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide.
Molecular Properties
| Compound Name | 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide |
| PubChem CID | 43706315 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide |
| SMILES | CC(NC(=O)CCCCCN)c1nncn1C |
| InChI | InChI=1S/C11H21N5O/c1-9(11-15-13-8-16(11)2)14-10(17)6-4-3-5-7-12/h8-9H,3-7,12H2,1-2H3,(H,14,17) |
| InChIKey | CHHQVXZXSXKIEK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide?
The IUPAC name of 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide (CID 43706315) is 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide.
What is the SMILES notation for 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide?
The canonical SMILES for 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide is CC(NC(=O)CCCCCN)c1nncn1C.
What is the InChIKey of 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide?
The InChIKey is CHHQVXZXSXKIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5O/c1-9(11-15-13-8-16(11)2)14-10(17)6-4-3-5-7-12/h8-9H,3-7,12H2,1-2H3,(H,14,17).
What are the key properties of 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide?
6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide has a molecular weight of 239.32 g/mol, XLogP of 0.51, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexanamide is sourced from PubChem (CID 43706315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).