C15H21N3O2 — CID 43708790
7-amino-N-[3-(cyanomethoxy)phenyl]heptanamide (PubChem CID 43708790) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 7-amino-N-[3-(cyanomethoxy)phenyl]heptanamide.
| Compound Name | 7-amino-N-[3-(cyanomethoxy)phenyl]heptanamide |
|---|---|
| PubChem CID | 43708790 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 7-amino-N-[3-(cyanomethoxy)phenyl]heptanamide |
| SMILES | N#CCOc1cccc(NC(=O)CCCCCCN)c1 |
| InChI | InChI=1S/C15H21N3O2/c16-9-4-2-1-3-8-15(19)18-13-6-5-7-14(12-13)20-11-10-17/h5-7,12H,1-4,8-9,11,16H2,(H,18,19) |
| InChIKey | YYSCKLLQHPBITF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|