C11H14ClFN2O — CID 43708823
2-amino-N-(4-chloro-3-fluorophenyl)-3-methylbutanamide (PubChem CID 43708823) has the molecular formula C11H14ClFN2O and a molecular weight of 244.70 g/mol. Its IUPAC name is 2-amino-N-(4-chloro-3-fluorophenyl)-3-methylbutanamide.
| Compound Name | 2-amino-N-(4-chloro-3-fluorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 43708823 |
| Molecular Formula | C11H14ClFN2O |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-amino-N-(4-chloro-3-fluorophenyl)-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H14ClFN2O/c1-6(2)10(14)11(16)15-7-3-4-8(12)9(13)5-7/h3-6,10H,14H2,1-2H3,(H,15,16) |
| InChIKey | NGAHJAAWVNUMDA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |