C16H14BrN3O — CID 43708855
5-[4-[(3-bromophenyl)methylamino]phenyl]-1,2-dihydropyrazol-3-one (PubChem CID 43708855) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-[4-[(3-bromophenyl)methylamino]phenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[4-[(3-bromophenyl)methylamino]phenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 43708855 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 5-[4-[(3-bromophenyl)methylamino]phenyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(-c2ccc(NCc3cccc(Br)c3)cc2)[nH][nH]1 |
| InChI | InChI=1S/C16H14BrN3O/c17-13-3-1-2-11(8-13)10-18-14-6-4-12(5-7-14)15-9-16(21)20-19-15/h1-9,18H,10H2,(H2,19,20,21) |
| InChIKey | WBQBAWMKBCYEAD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |