C16H18N2OS — CID 43709708
N-(2-thiophen-2-ylphenyl)piperidine-3-carboxamide (PubChem CID 43709708) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(2-thiophen-2-ylphenyl)piperidine-3-carboxamide.
| Compound Name | N-(2-thiophen-2-ylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43709708 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-(2-thiophen-2-ylphenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1cccs1)C1CCCNC1 |
| InChI | InChI=1S/C16H18N2OS/c19-16(12-5-3-9-17-11-12)18-14-7-2-1-6-13(14)15-8-4-10-20-15/h1-2,4,6-8,10,12,17H,3,5,9,11H2,(H,18,19) |
| InChIKey | CKFVAFYVWHNEQS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |