C11H13F2N3O3 — CID 43709921
2-amino-N-(2,4-difluoro-5-nitrophenyl)pentanamide (PubChem CID 43709921) has the molecular formula C11H13F2N3O3 and a molecular weight of 273.24 g/mol. Its IUPAC name is 2-amino-N-(2,4-difluoro-5-nitrophenyl)pentanamide.
| Compound Name | 2-amino-N-(2,4-difluoro-5-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 43709921 |
| Molecular Formula | C11H13F2N3O3 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-amino-N-(2,4-difluoro-5-nitrophenyl)pentanamide |
| SMILES | CCCC(N)C(=O)Nc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C11H13F2N3O3/c1-2-3-8(14)11(17)15-9-5-10(16(18)19)7(13)4-6(9)12/h4-5,8H,2-3,14H2,1H3,(H,15,17) |
| InChIKey | PNEUYSAOBDNXJW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|