About N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine
N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine (PubChem CID 43710182) has the molecular formula C20H33N
and a molecular weight of 287.49 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine |
| PubChem CID | 43710182 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine |
| SMILES | Cc1ccc(C(C)NC2CC(C)CCC2C(C)C)cc1C |
| InChI | InChI=1S/C20H33N/c1-13(2)19-10-7-14(3)11-20(19)21-17(6)18-9-8-15(4)16(5)12-18/h8-9,12-14,17,19-21H,7,10-11H2,1-6H3 |
| InChIKey | QNHZBAMJWJWZDQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine?
The IUPAC name of N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine (CID 43710182) is N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine.
What is the SMILES notation for N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine?
The canonical SMILES for N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine is Cc1ccc(C(C)NC2CC(C)CCC2C(C)C)cc1C.
What is the InChIKey of N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine?
The InChIKey is QNHZBAMJWJWZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N/c1-13(2)19-10-7-14(3)11-20(19)21-17(6)18-9-8-15(4)16(5)12-18/h8-9,12-14,17,19-21H,7,10-11H2,1-6H3.
What are the key properties of N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine?
N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine has a molecular weight of 287.49 g/mol, XLogP of 5.41, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dimethylphenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine is sourced from PubChem (CID 43710182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).