About 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide
2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide (PubChem CID 43710204) has the molecular formula C15H26N2O3S
and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide.
Molecular Properties
| Compound Name | 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide |
| PubChem CID | 43710204 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C15H26N2O3S/c1-21(19,20)6-5-13(16)15(18)17-14-8-9-7-12(14)11-4-2-3-10(9)11/h9-14H,2-8,16H2,1H3,(H,17,18) |
| InChIKey | WGRWPMZRYKFFIV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide?
The IUPAC name of 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide (CID 43710204) is 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide.
What is the SMILES notation for 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide?
The canonical SMILES for 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide is CS(=O)(=O)CCC(N)C(=O)NC1CC2CC1C1CCCC21.
What is the InChIKey of 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide?
The InChIKey is WGRWPMZRYKFFIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3S/c1-21(19,20)6-5-13(16)15(18)17-14-8-9-7-12(14)11-4-2-3-10(9)11/h9-14H,2-8,16H2,1H3,(H,17,18).
What are the key properties of 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide?
2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide has a molecular weight of 314.45 g/mol, XLogP of 0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methylsulfonyl-N-(8-tricyclo[5.2.1.02,6]decanyl)butanamide is sourced from PubChem (CID 43710204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).