About N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide
N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 43710344) has the molecular formula C12H13BrN4O3
and a molecular weight of 341.17 g/mol. Its IUPAC name is N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide |
| PubChem CID | 43710344 |
| Molecular Formula | C12H13BrN4O3 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc2[nH]c(=O)[nH]c2cc1Br)C1CC(O)CN1 |
| InChI | InChI=1S/C12H13BrN4O3/c13-6-2-8-9(17-12(20)16-8)3-7(6)15-11(19)10-1-5(18)4-14-10/h2-3,5,10,14,18H,1,4H2,(H,15,19)(H2,16,17,20) |
| InChIKey | GLFOYDYBLOBZLU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide?
The IUPAC name of N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide (CID 43710344) is N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide.
What is the SMILES notation for N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide?
The canonical SMILES for N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide is O=C(Nc1cc2[nH]c(=O)[nH]c2cc1Br)C1CC(O)CN1.
What is the InChIKey of N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide?
The InChIKey is GLFOYDYBLOBZLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN4O3/c13-6-2-8-9(17-12(20)16-8)3-7(6)15-11(19)10-1-5(18)4-14-10/h2-3,5,10,14,18H,1,4H2,(H,15,19)(H2,16,17,20).
What are the key properties of N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide?
N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide has a molecular weight of 341.17 g/mol, XLogP of 0.28, 2 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)-4-hydroxypyrrolidine-2-carboxamide is sourced from PubChem (CID 43710344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).