C15H14N4O — CID 43710788
2-(4-aminophenyl)-N-(1H-indazol-6-yl)acetamide (PubChem CID 43710788) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(1H-indazol-6-yl)acetamide.
| Compound Name | 2-(4-aminophenyl)-N-(1H-indazol-6-yl)acetamide |
|---|---|
| PubChem CID | 43710788 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(4-aminophenyl)-N-(1H-indazol-6-yl)acetamide |
| SMILES | Nc1ccc(CC(=O)Nc2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C15H14N4O/c16-12-4-1-10(2-5-12)7-15(20)18-13-6-3-11-9-17-19-14(11)8-13/h1-6,8-9H,7,16H2,(H,17,19)(H,18,20) |
| InChIKey | ITABSSKJXREELI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|