C15H19F3N2O — CID 43712748
4-amino-3-methyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 43712748) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-amino-3-methyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 4-amino-3-methyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 43712748 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-amino-3-methyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2C(F)(F)F)ccc1N |
| InChI | InChI=1S/C15H19F3N2O/c1-9-8-10(6-7-12(9)19)14(21)20-13-5-3-2-4-11(13)15(16,17)18/h6-8,11,13H,2-5,19H2,1H3,(H,20,21) |
| InChIKey | AKJDGOVMNRWORH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|