C16H16Cl2N2O — CID 43713979
2-[4-[(2,4-dichlorophenyl)methylamino]phenyl]-N-methylacetamide (PubChem CID 43713979) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 2-[4-[(2,4-dichlorophenyl)methylamino]phenyl]-N-methylacetamide.
| Compound Name | 2-[4-[(2,4-dichlorophenyl)methylamino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 43713979 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-[4-[(2,4-dichlorophenyl)methylamino]phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccc(NCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-19-16(21)8-11-2-6-14(7-3-11)20-10-12-4-5-13(17)9-15(12)18/h2-7,9,20H,8,10H2,1H3,(H,19,21) |
| InChIKey | PSUMLEODTMCYEJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |