C10H11NO6S — CID 43715539
3-(carboxymethylsulfonylamino)-4-methylbenzoic acid (PubChem CID 43715539) has the molecular formula C10H11NO6S and a molecular weight of 273.27 g/mol. Its IUPAC name is 3-(carboxymethylsulfonylamino)-4-methylbenzoic acid.
| Compound Name | 3-(carboxymethylsulfonylamino)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 43715539 |
| Molecular Formula | C10H11NO6S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3-(carboxymethylsulfonylamino)-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C10H11NO6S/c1-6-2-3-7(10(14)15)4-8(6)11-18(16,17)5-9(12)13/h2-4,11H,5H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | VKYNSDFDASVFQB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |