C11H11FN2O4S — CID 43715608
3-[(5-cyano-3-fluoro-2-methylphenyl)sulfamoyl]propanoic acid (PubChem CID 43715608) has the molecular formula C11H11FN2O4S and a molecular weight of 286.28 g/mol. Its IUPAC name is 3-[(5-cyano-3-fluoro-2-methylphenyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(5-cyano-3-fluoro-2-methylphenyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 43715608 |
| Molecular Formula | C11H11FN2O4S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 3-[(5-cyano-3-fluoro-2-methylphenyl)sulfamoyl]propanoic acid |
| SMILES | Cc1c(F)cc(C#N)cc1NS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C11H11FN2O4S/c1-7-9(12)4-8(6-13)5-10(7)14-19(17,18)3-2-11(15)16/h4-5,14H,2-3H2,1H3,(H,15,16) |
| InChIKey | CZEDHWUEAIDVNE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |