C13H17N3Se — CID 43715874
N-(4-methylcyclohexyl)-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43715874) has the molecular formula C13H17N3Se and a molecular weight of 294.26 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-(4-methylcyclohexyl)-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43715874 |
| Molecular Formula | C13H17N3Se |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(4-methylcyclohexyl)-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CC1CCC(Nc2cccc3n[se]nc23)CC1 |
| InChI | InChI=1S/C13H17N3Se/c1-9-5-7-10(8-6-9)14-11-3-2-4-12-13(11)16-17-15-12/h2-4,9-10,14H,5-8H2,1H3 |
| InChIKey | IXXRQSLOFLGOSK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|