C14H10Cl2FN3Se — CID 43715978
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43715978) has the molecular formula C14H10Cl2FN3Se and a molecular weight of 389.12 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43715978 |
| Molecular Formula | C14H10Cl2FN3Se |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CC(Nc1cccc2n[se]nc12)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C14H10Cl2FN3Se/c1-7(12-8(15)5-6-9(17)13(12)16)18-10-3-2-4-11-14(10)20-21-19-11/h2-7,18H,1H3 |
| InChIKey | APPDHTLLNXFFPM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|