C15H14F2IN — CID 43717020
N-[1-(2,6-difluorophenyl)ethyl]-4-iodo-2-methylaniline (PubChem CID 43717020) has the molecular formula C15H14F2IN and a molecular weight of 373.18 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethyl]-4-iodo-2-methylaniline.
| Compound Name | N-[1-(2,6-difluorophenyl)ethyl]-4-iodo-2-methylaniline |
|---|---|
| PubChem CID | 43717020 |
| Molecular Formula | C15H14F2IN |
| Molecular Weight | 373.18 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethyl]-4-iodo-2-methylaniline |
| SMILES | Cc1cc(I)ccc1NC(C)c1c(F)cccc1F |
| InChI | InChI=1S/C15H14F2IN/c1-9-8-11(18)6-7-14(9)19-10(2)15-12(16)4-3-5-13(15)17/h3-8,10,19H,1-2H3 |
| InChIKey | VXOMBOWSSGVZSK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.18 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|