C20H27N — CID 43720327
N-[1-(2,4-dimethylphenyl)ethyl]-1-phenylbutan-1-amine (PubChem CID 43720327) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)ethyl]-1-phenylbutan-1-amine.
| Compound Name | N-[1-(2,4-dimethylphenyl)ethyl]-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 43720327 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)ethyl]-1-phenylbutan-1-amine |
| SMILES | CCCC(NC(C)c1ccc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C20H27N/c1-5-9-20(18-10-7-6-8-11-18)21-17(4)19-13-12-15(2)14-16(19)3/h6-8,10-14,17,20-21H,5,9H2,1-4H3 |
| InChIKey | BTNBMYUVEAYUSD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |