C17H16N2O — CID 43721237
2-[3-(2,3-dihydro-1H-inden-1-ylamino)phenoxy]acetonitrile (PubChem CID 43721237) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1H-inden-1-ylamino)phenoxy]acetonitrile.
| Compound Name | 2-[3-(2,3-dihydro-1H-inden-1-ylamino)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 43721237 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-[3-(2,3-dihydro-1H-inden-1-ylamino)phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(NC2CCc3ccccc32)c1 |
| InChI | InChI=1S/C17H16N2O/c18-10-11-20-15-6-3-5-14(12-15)19-17-9-8-13-4-1-2-7-16(13)17/h1-7,12,17,19H,8-9,11H2 |
| InChIKey | GUESMBRRLMXKEZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |