About N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine
N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43721413) has the molecular formula C16H19ClFN
and a molecular weight of 279.79 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 43721413 |
| Molecular Formula | C16H19ClFN |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Fc1cc(NC2CC3CC2C2CCCC32)ccc1Cl |
| InChI | InChI=1S/C16H19ClFN/c17-14-5-4-10(8-15(14)18)19-16-7-9-6-13(16)12-3-1-2-11(9)12/h4-5,8-9,11-13,16,19H,1-3,6-7H2 |
| InChIKey | CTWDGYDSGMSAEM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine (CID 43721413) is N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine is Fc1cc(NC2CC3CC2C2CCCC32)ccc1Cl.
What is the InChIKey of N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is CTWDGYDSGMSAEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClFN/c17-14-5-4-10(8-15(14)18)19-16-7-9-6-13(16)12-3-1-2-11(9)12/h4-5,8-9,11-13,16,19H,1-3,6-7H2.
What are the key properties of N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine?
N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 279.79 g/mol, XLogP of 4.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-3-fluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 43721413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).