C16H29NS — CID 43722998
5-methyl-N-(2-methyl-1-thiophen-2-ylpropyl)heptan-3-amine (PubChem CID 43722998) has the molecular formula C16H29NS and a molecular weight of 267.48 g/mol. Its IUPAC name is 5-methyl-N-(2-methyl-1-thiophen-2-ylpropyl)heptan-3-amine.
| Compound Name | 5-methyl-N-(2-methyl-1-thiophen-2-ylpropyl)heptan-3-amine |
|---|---|
| PubChem CID | 43722998 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 5-methyl-N-(2-methyl-1-thiophen-2-ylpropyl)heptan-3-amine |
| SMILES | CCC(C)CC(CC)NC(c1cccs1)C(C)C |
| InChI | InChI=1S/C16H29NS/c1-6-13(5)11-14(7-2)17-16(12(3)4)15-9-8-10-18-15/h8-10,12-14,16-17H,6-7,11H2,1-5H3 |
| InChIKey | PRVFMBGNWNYBNL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |