About 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione
6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 43723406) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione.
Molecular Properties
| Compound Name | 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione |
| PubChem CID | 43723406 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(NC3CCCC3)cc2[nH]c1=O |
| InChI | InChI=1S/C13H15N3O2/c17-12-13(18)16-11-7-9(5-6-10(11)15-12)14-8-3-1-2-4-8/h5-8,14H,1-4H2,(H,15,17)(H,16,18) |
| InChIKey | IIXFNNMMDSDZEL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione?
The IUPAC name of 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione (CID 43723406) is 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione.
What is the SMILES notation for 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione?
The canonical SMILES for 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione is O=c1[nH]c2ccc(NC3CCCC3)cc2[nH]c1=O.
What is the InChIKey of 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione?
The InChIKey is IIXFNNMMDSDZEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c17-12-13(18)16-11-7-9(5-6-10(11)15-12)14-8-3-1-2-4-8/h5-8,14H,1-4H2,(H,15,17)(H,16,18).
What are the key properties of 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione?
6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione has a molecular weight of 245.28 g/mol, XLogP of 1.57, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclopentylamino)-1,4-dihydroquinoxaline-2,3-dione is sourced from PubChem (CID 43723406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).