About methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate
methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate (PubChem CID 43723736) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate |
| PubChem CID | 43723736 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC1CC(C)c2c(C)ccc(O)c21 |
| InChI | InChI=1S/C15H21NO3/c1-8-5-6-12(17)14-11(7-9(2)13(8)14)16-10(3)15(18)19-4/h5-6,9-11,16-17H,7H2,1-4H3/t9?,10-,11?/m0/s1 |
| InChIKey | XALQIXKQKWIAKD-YVNMAJEFSA-N |
| XLogP | 2.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate?
The IUPAC name of methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate (CID 43723736) is methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate.
What is the SMILES notation for methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate?
The canonical SMILES for methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate is COC(=O)[C@H](C)NC1CC(C)c2c(C)ccc(O)c21.
What is the InChIKey of methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate?
The InChIKey is XALQIXKQKWIAKD-YVNMAJEFSA-N. The full InChI is InChI=1S/C15H21NO3/c1-8-5-6-12(17)14-11(7-9(2)13(8)14)16-10(3)15(18)19-4/h5-6,9-11,16-17H,7H2,1-4H3/t9?,10-,11?/m0/s1.
What are the key properties of methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate?
methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate has a molecular weight of 263.34 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)amino]propanoate is sourced from PubChem (CID 43723736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).