About 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine
1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine (PubChem CID 43725542) has the molecular formula C17H20N4
and a molecular weight of 280.38 g/mol. Its IUPAC name is 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine |
| PubChem CID | 43725542 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine |
| SMILES | Cc1nn(C)c2ncc(NCC(C)c3ccccc3)cc12 |
| InChI | InChI=1S/C17H20N4/c1-12(14-7-5-4-6-8-14)10-18-15-9-16-13(2)20-21(3)17(16)19-11-15/h4-9,11-12,18H,10H2,1-3H3 |
| InChIKey | RFNXIELOSPBHDG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine?
The IUPAC name of 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine (CID 43725542) is 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine.
What is the SMILES notation for 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine?
The canonical SMILES for 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine is Cc1nn(C)c2ncc(NCC(C)c3ccccc3)cc12.
What is the InChIKey of 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine?
The InChIKey is RFNXIELOSPBHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4/c1-12(14-7-5-4-6-8-14)10-18-15-9-16-13(2)20-21(3)17(16)19-11-15/h4-9,11-12,18H,10H2,1-3H3.
What are the key properties of 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine?
1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine has a molecular weight of 280.38 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-N-(2-phenylpropyl)pyrazolo[5,4-b]pyridin-5-amine is sourced from PubChem (CID 43725542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).