About methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate
methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate (PubChem CID 43725802) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate |
| PubChem CID | 43725802 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(C)c1cnc2cc(C)nn2c1C |
| InChI | InChI=1S/C15H22N4O2/c1-9-7-13-16-8-12(11(3)19(13)18-9)10(2)17-15(4,5)14(20)21-6/h7-8,10,17H,1-6H3 |
| InChIKey | DBXFLTZQAPALSM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate?
The IUPAC name of methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate (CID 43725802) is methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate.
What is the SMILES notation for methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate?
The canonical SMILES for methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate is COC(=O)C(C)(C)NC(C)c1cnc2cc(C)nn2c1C.
What is the InChIKey of methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate?
The InChIKey is DBXFLTZQAPALSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-9-7-13-16-8-12(11(3)19(13)18-9)10(2)17-15(4,5)14(20)21-6/h7-8,10,17H,1-6H3.
What are the key properties of methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate?
methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate has a molecular weight of 290.37 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]-2-methylpropanoate is sourced from PubChem (CID 43725802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).