C16H19NS2 — CID 43726306
4-cyclopentylsulfanyl-N-(thiophen-2-ylmethyl)aniline (PubChem CID 43726306) has the molecular formula C16H19NS2 and a molecular weight of 289.47 g/mol. Its IUPAC name is 4-cyclopentylsulfanyl-N-(thiophen-2-ylmethyl)aniline.
| Compound Name | 4-cyclopentylsulfanyl-N-(thiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 43726306 |
| Molecular Formula | C16H19NS2 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-cyclopentylsulfanyl-N-(thiophen-2-ylmethyl)aniline |
| SMILES | c1csc(CNc2ccc(SC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C16H19NS2/c1-2-5-14(4-1)19-15-9-7-13(8-10-15)17-12-16-6-3-11-18-16/h3,6-11,14,17H,1-2,4-5,12H2 |
| InChIKey | BGXMSVDNIHBVCY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |