C18H20ClNS — CID 43726334
N-[(3-chlorophenyl)methyl]-4-cyclopentylsulfanylaniline (PubChem CID 43726334) has the molecular formula C18H20ClNS and a molecular weight of 317.88 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-cyclopentylsulfanylaniline.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-cyclopentylsulfanylaniline |
|---|---|
| PubChem CID | 43726334 |
| Molecular Formula | C18H20ClNS |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-cyclopentylsulfanylaniline |
| SMILES | Clc1cccc(CNc2ccc(SC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C18H20ClNS/c19-15-5-3-4-14(12-15)13-20-16-8-10-18(11-9-16)21-17-6-1-2-7-17/h3-5,8-12,17,20H,1-2,6-7,13H2 |
| InChIKey | MMTMWOHFMRADQH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |