About N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43726759) has the molecular formula C16H25N3
and a molecular weight of 259.40 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 43726759 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Cc1n[nH]c(C)c1CNC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C16H25N3/c1-9-15(10(2)19-18-9)8-17-16-7-11-6-14(16)13-5-3-4-12(11)13/h11-14,16-17H,3-8H2,1-2H3,(H,18,19) |
| InChIKey | ZZVWUBITXSWZQZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (CID 43726759) is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine is Cc1n[nH]c(C)c1CNC1CC2CC1C1CCCC21.
What is the InChIKey of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is ZZVWUBITXSWZQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3/c1-9-15(10(2)19-18-9)8-17-16-7-11-6-14(16)13-5-3-4-12(11)13/h11-14,16-17H,3-8H2,1-2H3,(H,18,19).
What are the key properties of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 259.40 g/mol, XLogP of 2.94, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 43726759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).