C17H23N3O — CID 43727389
4-methyl-2-[1-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]ethyl]phenol (PubChem CID 43727389) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-methyl-2-[1-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]ethyl]phenol.
| Compound Name | 4-methyl-2-[1-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 43727389 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 4-methyl-2-[1-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]ethyl]phenol |
| SMILES | Cc1ccc(O)c(C(C)NC2CCCc3c2cnn3C)c1 |
| InChI | InChI=1S/C17H23N3O/c1-11-7-8-17(21)13(9-11)12(2)19-15-5-4-6-16-14(15)10-18-20(16)3/h7-10,12,15,19,21H,4-6H2,1-3H3 |
| InChIKey | LSLPSWBIAQWRQR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|