C15H15ClFNO2S — CID 43727599
3-[1-(3-chloro-4-fluorophenyl)ethylamino]-3-thiophen-2-ylpropanoic acid (PubChem CID 43727599) has the molecular formula C15H15ClFNO2S and a molecular weight of 327.81 g/mol. Its IUPAC name is 3-[1-(3-chloro-4-fluorophenyl)ethylamino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[1-(3-chloro-4-fluorophenyl)ethylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 43727599 |
| Molecular Formula | C15H15ClFNO2S |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 3-[1-(3-chloro-4-fluorophenyl)ethylamino]-3-thiophen-2-ylpropanoic acid |
| SMILES | CC(NC(CC(=O)O)c1cccs1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H15ClFNO2S/c1-9(10-4-5-12(17)11(16)7-10)18-13(8-15(19)20)14-3-2-6-21-14/h2-7,9,13,18H,8H2,1H3,(H,19,20) |
| InChIKey | LDPYQYKJNJJXMZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |