C14H19FN2 — CID 43728330
3-(2-ethylbutylamino)-5-fluoro-4-methylbenzonitrile (PubChem CID 43728330) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is 3-(2-ethylbutylamino)-5-fluoro-4-methylbenzonitrile.
| Compound Name | 3-(2-ethylbutylamino)-5-fluoro-4-methylbenzonitrile |
|---|---|
| PubChem CID | 43728330 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-(2-ethylbutylamino)-5-fluoro-4-methylbenzonitrile |
| SMILES | CCC(CC)CNc1cc(C#N)cc(F)c1C |
| InChI | InChI=1S/C14H19FN2/c1-4-11(5-2)9-17-14-7-12(8-16)6-13(15)10(14)3/h6-7,11,17H,4-5,9H2,1-3H3 |
| InChIKey | JPIYBNUQXOMPSB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |