About 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline
5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline (PubChem CID 43729386) has the molecular formula C14H17BrN2S
and a molecular weight of 325.28 g/mol. Its IUPAC name is 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline.
Molecular Properties
| Compound Name | 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline |
| PubChem CID | 43729386 |
| Molecular Formula | C14H17BrN2S |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline |
| SMILES | Cc1nc(C(C)Nc2cc(Br)ccc2C)c(C)s1 |
| InChI | InChI=1S/C14H17BrN2S/c1-8-5-6-12(15)7-13(8)16-9(2)14-10(3)18-11(4)17-14/h5-7,9,16H,1-4H3 |
| InChIKey | QADFRJQMAQYVSW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline?
The IUPAC name of 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline (CID 43729386) is 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline.
What is the SMILES notation for 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline?
The canonical SMILES for 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline is Cc1nc(C(C)Nc2cc(Br)ccc2C)c(C)s1.
What is the InChIKey of 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline?
The InChIKey is QADFRJQMAQYVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2S/c1-8-5-6-12(15)7-13(8)16-9(2)14-10(3)18-11(4)17-14/h5-7,9,16H,1-4H3.
What are the key properties of 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline?
5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline has a molecular weight of 325.28 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-2-methylaniline is sourced from PubChem (CID 43729386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).