C16H18BrN — CID 43729393
5-bromo-2-methyl-N-(3-phenylpropyl)aniline (PubChem CID 43729393) has the molecular formula C16H18BrN and a molecular weight of 304.23 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(3-phenylpropyl)aniline.
| Compound Name | 5-bromo-2-methyl-N-(3-phenylpropyl)aniline |
|---|---|
| PubChem CID | 43729393 |
| Molecular Formula | C16H18BrN |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-bromo-2-methyl-N-(3-phenylpropyl)aniline |
| SMILES | Cc1ccc(Br)cc1NCCCc1ccccc1 |
| InChI | InChI=1S/C16H18BrN/c1-13-9-10-15(17)12-16(13)18-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-10,12,18H,5,8,11H2,1H3 |
| InChIKey | WFNDAKKZLCKEPJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|