C13H19N3 — CID 43730763
N-(2-methylpentyl)-1H-indazol-7-amine (PubChem CID 43730763) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-(2-methylpentyl)-1H-indazol-7-amine.
| Compound Name | N-(2-methylpentyl)-1H-indazol-7-amine |
|---|---|
| PubChem CID | 43730763 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-(2-methylpentyl)-1H-indazol-7-amine |
| SMILES | CCCC(C)CNc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C13H19N3/c1-3-5-10(2)8-14-12-7-4-6-11-9-15-16-13(11)12/h4,6-7,9-10,14H,3,5,8H2,1-2H3,(H,15,16) |
| InChIKey | SNNMEQTWXULRNG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |