C13H12BrFN2OS — CID 43735810
3-[(5-bromothiophen-3-yl)methylamino]-5-fluoro-4-methylbenzamide (PubChem CID 43735810) has the molecular formula C13H12BrFN2OS and a molecular weight of 343.22 g/mol. Its IUPAC name is 3-[(5-bromothiophen-3-yl)methylamino]-5-fluoro-4-methylbenzamide.
| Compound Name | 3-[(5-bromothiophen-3-yl)methylamino]-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 43735810 |
| Molecular Formula | C13H12BrFN2OS |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 3-[(5-bromothiophen-3-yl)methylamino]-5-fluoro-4-methylbenzamide |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NCc1csc(Br)c1 |
| InChI | InChI=1S/C13H12BrFN2OS/c1-7-10(15)3-9(13(16)18)4-11(7)17-5-8-2-12(14)19-6-8/h2-4,6,17H,5H2,1H3,(H2,16,18) |
| InChIKey | PQHNUCCNXOHAMK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |