C17H18ClNO2 — CID 43736124
4-[1-(3-chlorophenyl)propylamino]-3-methylbenzoic acid (PubChem CID 43736124) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is 4-[1-(3-chlorophenyl)propylamino]-3-methylbenzoic acid.
| Compound Name | 4-[1-(3-chlorophenyl)propylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 43736124 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 4-[1-(3-chlorophenyl)propylamino]-3-methylbenzoic acid |
| SMILES | CCC(Nc1ccc(C(=O)O)cc1C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H18ClNO2/c1-3-15(12-5-4-6-14(18)10-12)19-16-8-7-13(17(20)21)9-11(16)2/h4-10,15,19H,3H2,1-2H3,(H,20,21) |
| InChIKey | VLCSHNXIBFAVMI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |