C16H17Br2N — CID 43736754
2,5-dibromo-N-[1-(4-ethylphenyl)ethyl]aniline (PubChem CID 43736754) has the molecular formula C16H17Br2N and a molecular weight of 383.13 g/mol. Its IUPAC name is 2,5-dibromo-N-[1-(4-ethylphenyl)ethyl]aniline.
| Compound Name | 2,5-dibromo-N-[1-(4-ethylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43736754 |
| Molecular Formula | C16H17Br2N |
| Molecular Weight | 383.13 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 2,5-dibromo-N-[1-(4-ethylphenyl)ethyl]aniline |
| SMILES | CCc1ccc(C(C)Nc2cc(Br)ccc2Br)cc1 |
| InChI | InChI=1S/C16H17Br2N/c1-3-12-4-6-13(7-5-12)11(2)19-16-10-14(17)8-9-15(16)18/h4-11,19H,3H2,1-2H3 |
| InChIKey | TZUHFBFYJVQHKZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.13 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |