About 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one
3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one (PubChem CID 43739009) has the molecular formula C17H18N2O2
and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one |
| PubChem CID | 43739009 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one |
| SMILES | COc1c(C)ccc(NC2C(=O)Nc3ccccc32)c1C |
| InChI | InChI=1S/C17H18N2O2/c1-10-8-9-13(11(2)16(10)21-3)18-15-12-6-4-5-7-14(12)19-17(15)20/h4-9,15,18H,1-3H3,(H,19,20) |
| InChIKey | JHTVXTPXPUGKBI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one?
The IUPAC name of 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one (CID 43739009) is 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one?
The canonical SMILES for 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one is COc1c(C)ccc(NC2C(=O)Nc3ccccc32)c1C.
What is the InChIKey of 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one?
The InChIKey is JHTVXTPXPUGKBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O2/c1-10-8-9-13(11(2)16(10)21-3)18-15-12-6-4-5-7-14(12)19-17(15)20/h4-9,15,18H,1-3H3,(H,19,20).
What are the key properties of 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one?
3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one has a molecular weight of 282.34 g/mol, XLogP of 3.42, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxy-2,4-dimethylanilino)-1,3-dihydroindol-2-one is sourced from PubChem (CID 43739009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).